C24H21F2N7O2S — CID 59332492
2-[[6-fluoro-4-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]-3-pyridinyl]methoxy]ethanol (PubChem CID 59332492) has the molecular formula C24H21F2N7O2S and a molecular weight of 509.54 g/mol. Its IUPAC name is 2-[[6-fluoro-4-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]-3-pyridinyl]methoxy]ethanol.
| Compound Name | 2-[[6-fluoro-4-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]-3-pyridinyl]methoxy]ethanol |
|---|---|
| PubChem CID | 59332492 |
| Molecular Formula | C24H21F2N7O2S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 2-[[6-fluoro-4-[2-[5-fluoro-2-[2-(triazol-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]-3-pyridinyl]methoxy]ethanol |
| SMILES | OCCOCc1cnc(F)cc1-c1cccc2cc(-c3nc(NCCn4ccnn4)ncc3F)sc12 |
| InChI | InChI=1S/C24H21F2N7O2S/c25-19-13-29-24(27-4-6-33-7-5-30-32-33)31-22(19)20-10-15-2-1-3-17(23(15)36-20)18-11-21(26)28-12-16(18)14-35-9-8-34/h1-3,5,7,10-13,34H,4,6,8-9,14H2,(H,27,29,31) |
| InChIKey | MZDBOBIIEUENPY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|