C25H22F2N8OS — CID 59267437
2-[[6-fluoro-4-[2-[5-fluoro-2-[2-(2-oxoimidazolidin-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]-3-pyridinyl]methylamino]acetonitrile (PubChem CID 59267437) has the molecular formula C25H22F2N8OS and a molecular weight of 520.57 g/mol. Its IUPAC name is 2-[[6-fluoro-4-[2-[5-fluoro-2-[2-(2-oxoimidazolidin-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]-3-pyridinyl]methylamino]acetonitrile.
| Compound Name | 2-[[6-fluoro-4-[2-[5-fluoro-2-[2-(2-oxoimidazolidin-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]-3-pyridinyl]methylamino]acetonitrile |
|---|---|
| PubChem CID | 59267437 |
| Molecular Formula | C25H22F2N8OS |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-[[6-fluoro-4-[2-[5-fluoro-2-[2-(2-oxoimidazolidin-1-yl)ethylamino]pyrimidin-4-yl]-1-benzothiophen-7-yl]-3-pyridinyl]methylamino]acetonitrile |
| SMILES | N#CCNCc1cnc(F)cc1-c1cccc2cc(-c3nc(NCCN4CCNC4=O)ncc3F)sc12 |
| InChI | InChI=1S/C25H22F2N8OS/c26-19-14-33-24(30-6-8-35-9-7-31-25(35)36)34-22(19)20-10-15-2-1-3-17(23(15)37-20)18-11-21(27)32-13-16(18)12-29-5-4-28/h1-3,10-11,13-14,29H,5-9,12H2,(H,31,36)(H,30,33,34) |
| InChIKey | CRJZMKYTZMZECY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|