C5H10ClF3N2 — CID 86641156
3,3,3-trifluoro-2,2-dimethylpropanimidamide;hydrochloride (PubChem CID 86641156) has the molecular formula C5H10ClF3N2 and a molecular weight of 190.60 g/mol. Its IUPAC name is 3,3,3-trifluoro-2,2-dimethylpropanimidamide;hydrochloride.
| Compound Name | 3,3,3-trifluoro-2,2-dimethylpropanimidamide;hydrochloride |
|---|---|
| PubChem CID | 86641156 |
| Molecular Formula | C5H10ClF3N2 |
| Molecular Weight | 190.60 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 3,3,3-trifluoro-2,2-dimethylpropanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C5H9F3N2.ClH/c1-4(2,3(9)10)5(6,7)8;/h1-2H3,(H3,9,10);1H |
| InChIKey | OYQDMRGNHICRIN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.60 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|