C6H12F2N2 — CID 115011786
2,2-difluoro-3,3-dimethylbutanimidamide (PubChem CID 115011786) has the molecular formula C6H12F2N2 and a molecular weight of 150.17 g/mol. Its IUPAC name is 2,2-difluoro-3,3-dimethylbutanimidamide.
| Compound Name | 2,2-difluoro-3,3-dimethylbutanimidamide |
|---|---|
| PubChem CID | 115011786 |
| Molecular Formula | C6H12F2N2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2,2-difluoro-3,3-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(F)(F)C(C)(C)C |
| InChI | InChI=1S/C6H12F2N2/c1-5(2,3)6(7,8)4(9)10/h1-3H3,(H3,9,10) |
| InChIKey | GRLLFQGIMHDHCQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|