C10H12N2O3 — CID 86643537
4-benzyl-5-hydroxy-3-methyl-1,3,4-oxadiazolidin-2-one (PubChem CID 86643537) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-benzyl-5-hydroxy-3-methyl-1,3,4-oxadiazolidin-2-one.
| Compound Name | 4-benzyl-5-hydroxy-3-methyl-1,3,4-oxadiazolidin-2-one |
|---|---|
| PubChem CID | 86643537 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-benzyl-5-hydroxy-3-methyl-1,3,4-oxadiazolidin-2-one |
| SMILES | CN1C(=O)OC(O)N1Cc1ccccc1 |
| InChI | InChI=1S/C10H12N2O3/c1-11-9(13)15-10(14)12(11)7-8-5-3-2-4-6-8/h2-6,10,14H,7H2,1H3 |
| InChIKey | SVONWQSGIAXONG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |