C25H23F9N4O5 — CID 86646545
3-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-2-ium-6-one;2,2,2-trifluoroacetate (PubChem CID 86646545) has the molecular formula C25H23F9N4O5 and a molecular weight of 630.46 g/mol. Its IUPAC name is 3-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-2-ium-6-one;2,2,2-trifluoroacetate.
| Compound Name | 3-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-2-ium-6-one;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 86646545 |
| Molecular Formula | C25H23F9N4O5 |
| Molecular Weight | 630.46 g/mol |
| Exact Mass | 630.15 |
| IUPAC Name | 3-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-2-ium-6-one;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.O=C(c1cc(Cc2cc(C(F)(F)C(F)(F)F)c(=O)[nH][nH+]2)ccc1F)N1CCN(C2CCCC2)C(=O)C1 |
| InChI | InChI=1S/C23H22F6N4O3.C2HF3O2/c24-18-6-5-13(9-14-11-17(20(35)31-30-14)22(25,26)23(27,28)29)10-16(18)21(36)32-7-8-33(19(34)12-32)15-3-1-2-4-15;3-2(4,5)1(6)7/h5-6,10-11,15H,1-4,7-9,12H2,(H,31,35);(H,6,7) |
| InChIKey | BUBGQZGDPNUYFT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|