C25H22F9N4O5+ — CID 87477987
[3-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-6-oxo-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-2-ium-2-yl] 2,2,2-trifluoroacetate (PubChem CID 87477987) has the molecular formula C25H22F9N4O5+ and a molecular weight of 629.46 g/mol. Its IUPAC name is [3-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-6-oxo-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-2-ium-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-6-oxo-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-2-ium-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87477987 |
| Molecular Formula | C25H22F9N4O5+ |
| Molecular Weight | 629.46 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | [3-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-6-oxo-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyridazin-2-ium-2-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(c1cc(Cc2cc(C(F)(F)C(F)(F)F)c(=O)[nH][n+]2OC(=O)C(F)(F)F)ccc1F)N1CCN(C2CCCC2)C(=O)C1 |
| InChI | InChI=1S/C25H21F9N4O5/c26-18-6-5-13(10-16(18)21(41)36-7-8-37(19(39)12-36)14-3-1-2-4-14)9-15-11-17(23(27,28)25(32,33)34)20(40)35-38(15)43-22(42)24(29,30)31/h5-6,10-11,14H,1-4,7-9,12H2/p+1 |
| InChIKey | TVIMZYZPOGJYAR-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|