C25H27F4N4O5+ — CID 68501657
[3-[[4-fluoro-3-(6-methyl-4-oxo-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazine-2-carbonyl)phenyl]methyl]-4,5-dimethyl-6-oxo-1H-pyridazin-2-ium-2-yl] 2,2,2-trifluoroacetate (PubChem CID 68501657) has the molecular formula C25H27F4N4O5+ and a molecular weight of 539.51 g/mol. Its IUPAC name is [3-[[4-fluoro-3-(6-methyl-4-oxo-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazine-2-carbonyl)phenyl]methyl]-4,5-dimethyl-6-oxo-1H-pyridazin-2-ium-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[4-fluoro-3-(6-methyl-4-oxo-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazine-2-carbonyl)phenyl]methyl]-4,5-dimethyl-6-oxo-1H-pyridazin-2-ium-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68501657 |
| Molecular Formula | C25H27F4N4O5+ |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | [3-[[4-fluoro-3-(6-methyl-4-oxo-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazine-2-carbonyl)phenyl]methyl]-4,5-dimethyl-6-oxo-1H-pyridazin-2-ium-2-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1c(C)c(=O)[nH][n+](OC(=O)C(F)(F)F)c1Cc1ccc(F)c(C(=O)N2CC(=O)N3C(C)CCCC3C2)c1 |
| InChI | InChI=1S/C25H26F4N4O5/c1-13-5-4-6-17-11-31(12-21(34)32(13)17)23(36)18-9-16(7-8-19(18)26)10-20-14(2)15(3)22(35)30-33(20)38-24(37)25(27,28)29/h7-9,13,17H,4-6,10-12H2,1-3H3/p+1 |
| InChIKey | RAQQNFJDNSIVPE-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|