C28H26F4N3O5+ — CID 87361359
[1-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-4-oxoquinolin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 87361359) has the molecular formula C28H26F4N3O5+ and a molecular weight of 560.52 g/mol. Its IUPAC name is [1-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-4-oxoquinolin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-4-oxoquinolin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87361359 |
| Molecular Formula | C28H26F4N3O5+ |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | [1-[[3-(4-cyclopentyl-3-oxopiperazine-1-carbonyl)-4-fluorophenyl]methyl]-4-oxoquinolin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C1C=C[N+](Cc2ccc(F)c(C(=O)N3CCN(C4CCCC4)C(=O)C3)c2)(OC(=O)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C28H26F4N3O5/c29-22-10-9-18(15-21(22)26(38)33-12-13-34(25(37)16-33)19-5-1-2-6-19)17-35(40-27(39)28(30,31)32)14-11-24(36)20-7-3-4-8-23(20)35/h3-4,7-11,14-15,19H,1-2,5-6,12-13,16-17H2/q+1 |
| InChIKey | JYGGEEBHSJKCPL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|