C15H17ClFNO4 — CID 86646599
dimethyl 2-(2-chloro-4-fluorophenyl)piperidine-1,4-dicarboxylate (PubChem CID 86646599) has the molecular formula C15H17ClFNO4 and a molecular weight of 329.75 g/mol. Its IUPAC name is dimethyl 2-(2-chloro-4-fluorophenyl)piperidine-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(2-chloro-4-fluorophenyl)piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 86646599 |
| Molecular Formula | C15H17ClFNO4 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | dimethyl 2-(2-chloro-4-fluorophenyl)piperidine-1,4-dicarboxylate |
| SMILES | COC(=O)C1CCN(C(=O)OC)C(c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C15H17ClFNO4/c1-21-14(19)9-5-6-18(15(20)22-2)13(7-9)11-4-3-10(17)8-12(11)16/h3-4,8-9,13H,5-7H2,1-2H3 |
| InChIKey | BRYYESSFTHZQEG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |