C18H14ClF2N3OS — CID 86648922
1-[[(2S,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-5-methylsulfanyl-1,2,4-triazole (PubChem CID 86648922) has the molecular formula C18H14ClF2N3OS and a molecular weight of 393.85 g/mol. Its IUPAC name is 1-[[(2S,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-5-methylsulfanyl-1,2,4-triazole.
| Compound Name | 1-[[(2S,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-5-methylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 86648922 |
| Molecular Formula | C18H14ClF2N3OS |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 1-[[(2S,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-5-methylsulfanyl-1,2,4-triazole |
| SMILES | CSc1ncnn1C[C@]1(c2ccc(F)cc2F)O[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C18H14ClF2N3OS/c1-26-17-22-10-23-24(17)9-18(13-7-6-11(20)8-15(13)21)16(25-18)12-4-2-3-5-14(12)19/h2-8,10,16H,9H2,1H3/t16-,18-/m1/s1 |
| InChIKey | GJMZYMJWYXRQPY-SJLPKXTDSA-N |
| XLogP | 4.60 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|