C22H19F3N2O5 — CID 86649395
methyl (2E)-2-[(1R,4R,5S,8S,12R)-7-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-2-ylidene]acetate (PubChem CID 86649395) has the molecular formula C22H19F3N2O5 and a molecular weight of 448.40 g/mol. Its IUPAC name is methyl (2E)-2-[(1R,4R,5S,8S,12R)-7-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-2-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(1R,4R,5S,8S,12R)-7-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-2-ylidene]acetate |
|---|---|
| PubChem CID | 86649395 |
| Molecular Formula | C22H19F3N2O5 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | methyl (2E)-2-[(1R,4R,5S,8S,12R)-7-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-2-ylidene]acetate |
| SMILES | COC(=O)/C=C1\C[C@@]2(C)O[C@@]13CCO[C@H]1[C@@H]3[C@@H]2C(=O)N1c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F3N2O5/c1-20-9-12(7-15(28)30-2)21(32-20)5-6-31-19-17(21)16(20)18(29)27(19)13-4-3-11(10-26)14(8-13)22(23,24)25/h3-4,7-8,16-17,19H,5-6,9H2,1-2H3/b12-7+/t16-,17+,19+,20-,21+/m1/s1 |
| InChIKey | HRJBXTSUOBNLCS-LJXKHPDPSA-N |
| XLogP | 2.93 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|