C20H18F3N3O4 — CID 59636038
4-[(1R,3E,4S,5S,8S,12R)-3-methoxyimino-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 59636038) has the molecular formula C20H18F3N3O4 and a molecular weight of 421.38 g/mol. Its IUPAC name is 4-[(1R,3E,4S,5S,8S,12R)-3-methoxyimino-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,3E,4S,5S,8S,12R)-3-methoxyimino-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59636038 |
| Molecular Formula | C20H18F3N3O4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 4-[(1R,3E,4S,5S,8S,12R)-3-methoxyimino-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CO/N=C1\C[C@@]23CCO[C@H]4[C@@H]2[C@H](C(=O)N4c2ccc(C#N)c(C(F)(F)F)c2)[C@]1(C)O3 |
| InChI | InChI=1S/C20H18F3N3O4/c1-18-13(25-28-2)8-19(30-18)5-6-29-17-15(19)14(18)16(27)26(17)11-4-3-10(9-24)12(7-11)20(21,22)23/h3-4,7,14-15,17H,5-6,8H2,1-2H3/b25-13+/t14-,15+,17+,18-,19+/m1/s1 |
| InChIKey | YARRGSVPBQSCAL-BWUOBYQDSA-N |
| XLogP | 2.84 |
| TPSA | 84.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|