C19H16F3N5O3 — CID 59635857
4-[(1R,3S,4S,5S,8S,12R)-3-azido-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 59635857) has the molecular formula C19H16F3N5O3 and a molecular weight of 419.36 g/mol. Its IUPAC name is 4-[(1R,3S,4S,5S,8S,12R)-3-azido-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1R,3S,4S,5S,8S,12R)-3-azido-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59635857 |
| Molecular Formula | C19H16F3N5O3 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 4-[(1R,3S,4S,5S,8S,12R)-3-azido-4-methyl-6-oxo-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-7-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12O[C@@]3(CCO[C@H]4[C@@H]3[C@@H]1C(=O)N4c1ccc(C#N)c(C(F)(F)F)c1)C[C@@H]2N=[N+]=[N-] |
| InChI | InChI=1S/C19H16F3N5O3/c1-17-12(25-26-24)7-18(30-17)4-5-29-16-14(18)13(17)15(28)27(16)10-3-2-9(8-23)11(6-10)19(20,21)22/h2-3,6,12-14,16H,4-5,7H2,1H3/t12-,13+,14-,16-,17+,18-/m0/s1 |
| InChIKey | JPDRVSZCTCSBPS-LAEBKXJHSA-N |
| XLogP | 3.51 |
| TPSA | 111.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|