C15H16Cl3FN2O2 — CID 86649529
(3R,7aR)-7a-[[(3-fluorophenyl)methylamino]methyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 86649529) has the molecular formula C15H16Cl3FN2O2 and a molecular weight of 381.66 g/mol. Its IUPAC name is (3R,7aR)-7a-[[(3-fluorophenyl)methylamino]methyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | (3R,7aR)-7a-[[(3-fluorophenyl)methylamino]methyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 86649529 |
| Molecular Formula | C15H16Cl3FN2O2 |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | (3R,7aR)-7a-[[(3-fluorophenyl)methylamino]methyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | O=C1O[C@H](C(Cl)(Cl)Cl)N2CCC[C@@]12CNCc1cccc(F)c1 |
| InChI | InChI=1S/C15H16Cl3FN2O2/c16-15(17,18)12-21-6-2-5-14(21,13(22)23-12)9-20-8-10-3-1-4-11(19)7-10/h1,3-4,7,12,20H,2,5-6,8-9H2/t12-,14-/m1/s1 |
| InChIKey | LHYDCAHZUIIXAI-TZMCWYRMSA-N |
| XLogP | 3.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|