C18H14ClN3 — CID 86649881
2-chloro-4-[2-methyl-4-[2-(3-methylphenyl)ethynyl]imidazol-1-yl]pyridine (PubChem CID 86649881) has the molecular formula C18H14ClN3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 2-chloro-4-[2-methyl-4-[2-(3-methylphenyl)ethynyl]imidazol-1-yl]pyridine.
| Compound Name | 2-chloro-4-[2-methyl-4-[2-(3-methylphenyl)ethynyl]imidazol-1-yl]pyridine |
|---|---|
| PubChem CID | 86649881 |
| Molecular Formula | C18H14ClN3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-chloro-4-[2-methyl-4-[2-(3-methylphenyl)ethynyl]imidazol-1-yl]pyridine |
| SMILES | Cc1cccc(C#Cc2cn(-c3ccnc(Cl)c3)c(C)n2)c1 |
| InChI | InChI=1S/C18H14ClN3/c1-13-4-3-5-15(10-13)6-7-16-12-22(14(2)21-16)17-8-9-20-18(19)11-17/h3-5,8-12H,1-2H3 |
| InChIKey | MYCDNCHVAPFDIO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|