C18H13ClFN3 — CID 86595315
2-chloro-4-[2-[1-(3-fluoro-4-methylphenyl)-2-methylimidazol-4-yl]ethynyl]pyridine (PubChem CID 86595315) has the molecular formula C18H13ClFN3 and a molecular weight of 325.77 g/mol. Its IUPAC name is 2-chloro-4-[2-[1-(3-fluoro-4-methylphenyl)-2-methylimidazol-4-yl]ethynyl]pyridine.
| Compound Name | 2-chloro-4-[2-[1-(3-fluoro-4-methylphenyl)-2-methylimidazol-4-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 86595315 |
| Molecular Formula | C18H13ClFN3 |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-chloro-4-[2-[1-(3-fluoro-4-methylphenyl)-2-methylimidazol-4-yl]ethynyl]pyridine |
| SMILES | Cc1ccc(-n2cc(C#Cc3ccnc(Cl)c3)nc2C)cc1F |
| InChI | InChI=1S/C18H13ClFN3/c1-12-3-6-16(10-17(12)20)23-11-15(22-13(23)2)5-4-14-7-8-21-18(19)9-14/h3,6-11H,1-2H3 |
| InChIKey | NWRKWFGXUPJQEM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|