C18H11FN4 — CID 24963367
4-[2-[1-(4-fluorophenyl)-2-methylimidazol-4-yl]ethynyl]pyridine-2-carbonitrile (PubChem CID 24963367) has the molecular formula C18H11FN4 and a molecular weight of 302.31 g/mol. Its IUPAC name is 4-[2-[1-(4-fluorophenyl)-2-methylimidazol-4-yl]ethynyl]pyridine-2-carbonitrile.
| Compound Name | 4-[2-[1-(4-fluorophenyl)-2-methylimidazol-4-yl]ethynyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 24963367 |
| Molecular Formula | C18H11FN4 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-[2-[1-(4-fluorophenyl)-2-methylimidazol-4-yl]ethynyl]pyridine-2-carbonitrile |
| SMILES | Cc1nc(C#Cc2ccnc(C#N)c2)cn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H11FN4/c1-13-22-16(5-2-14-8-9-21-17(10-14)11-20)12-23(13)18-6-3-15(19)4-7-18/h3-4,6-10,12H,1H3 |
| InChIKey | BUFRBQOWKOARSF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|