C22H23N5 — CID 10450985
2-methyl-4-[2-[2-methyl-1-(5-piperidin-1-yl-3-pyridinyl)imidazol-4-yl]ethynyl]pyridine (PubChem CID 10450985) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-methyl-4-[2-[2-methyl-1-(5-piperidin-1-yl-3-pyridinyl)imidazol-4-yl]ethynyl]pyridine.
| Compound Name | 2-methyl-4-[2-[2-methyl-1-(5-piperidin-1-yl-3-pyridinyl)imidazol-4-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 10450985 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 2-methyl-4-[2-[2-methyl-1-(5-piperidin-1-yl-3-pyridinyl)imidazol-4-yl]ethynyl]pyridine |
| SMILES | Cc1cc(C#Cc2cn(-c3cncc(N4CCCCC4)c3)c(C)n2)ccn1 |
| InChI | InChI=1S/C22H23N5/c1-17-12-19(8-9-24-17)6-7-20-16-27(18(2)25-20)22-13-21(14-23-15-22)26-10-4-3-5-11-26/h8-9,12-16H,3-5,10-11H2,1-2H3 |
| InChIKey | JXKVJQLBSMDLIJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|