C14H13F2N3 — CID 11196277
4-[2-[1-(2,2-difluoroethyl)-2-methylimidazol-4-yl]ethynyl]-2-methylpyridine (PubChem CID 11196277) has the molecular formula C14H13F2N3 and a molecular weight of 261.27 g/mol. Its IUPAC name is 4-[2-[1-(2,2-difluoroethyl)-2-methylimidazol-4-yl]ethynyl]-2-methylpyridine.
| Compound Name | 4-[2-[1-(2,2-difluoroethyl)-2-methylimidazol-4-yl]ethynyl]-2-methylpyridine |
|---|---|
| PubChem CID | 11196277 |
| Molecular Formula | C14H13F2N3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-[2-[1-(2,2-difluoroethyl)-2-methylimidazol-4-yl]ethynyl]-2-methylpyridine |
| SMILES | Cc1cc(C#Cc2cn(CC(F)F)c(C)n2)ccn1 |
| InChI | InChI=1S/C14H13F2N3/c1-10-7-12(5-6-17-10)3-4-13-8-19(9-14(15)16)11(2)18-13/h5-8,14H,9H2,1-2H3 |
| InChIKey | BVQXEPKBGFNUNE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|