C13H13N3 — CID 11148529
4-[2-(1,2-dimethylimidazol-4-yl)ethynyl]-2-methylpyridine (PubChem CID 11148529) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 4-[2-(1,2-dimethylimidazol-4-yl)ethynyl]-2-methylpyridine.
| Compound Name | 4-[2-(1,2-dimethylimidazol-4-yl)ethynyl]-2-methylpyridine |
|---|---|
| PubChem CID | 11148529 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-[2-(1,2-dimethylimidazol-4-yl)ethynyl]-2-methylpyridine |
| SMILES | Cc1cc(C#Cc2cn(C)c(C)n2)ccn1 |
| InChI | InChI=1S/C13H13N3/c1-10-8-12(6-7-14-10)4-5-13-9-16(3)11(2)15-13/h6-9H,1-3H3 |
| InChIKey | HKOHLJQHUXPSPK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|