C45H42ClF2N4O7P — CID 86650690
[3-[[4-[[2-(benzhydrylideneamino)-3-chloro-4-pyridinyl]oxy]-3-fluorophenyl]carbamoyl]-5-(4-fluorophenyl)-4-oxo-1-pyridinyl]methyl ditert-butyl phosphate (PubChem CID 86650690) has the molecular formula C45H42ClF2N4O7P and a molecular weight of 855.28 g/mol. Its IUPAC name is [3-[[4-[[2-(benzhydrylideneamino)-3-chloro-4-pyridinyl]oxy]-3-fluorophenyl]carbamoyl]-5-(4-fluorophenyl)-4-oxo-1-pyridinyl]methyl ditert-butyl phosphate.
| Compound Name | [3-[[4-[[2-(benzhydrylideneamino)-3-chloro-4-pyridinyl]oxy]-3-fluorophenyl]carbamoyl]-5-(4-fluorophenyl)-4-oxo-1-pyridinyl]methyl ditert-butyl phosphate |
|---|---|
| PubChem CID | 86650690 |
| Molecular Formula | C45H42ClF2N4O7P |
| Molecular Weight | 855.28 g/mol |
| Exact Mass | 854.24 |
| IUPAC Name | [3-[[4-[[2-(benzhydrylideneamino)-3-chloro-4-pyridinyl]oxy]-3-fluorophenyl]carbamoyl]-5-(4-fluorophenyl)-4-oxo-1-pyridinyl]methyl ditert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCn1cc(C(=O)Nc2ccc(Oc3ccnc(N=C(c4ccccc4)c4ccccc4)c3Cl)c(F)c2)c(=O)c(-c2ccc(F)cc2)c1)OC(C)(C)C |
| InChI | InChI=1S/C45H42ClF2N4O7P/c1-44(2,3)58-60(55,59-45(4,5)6)56-28-52-26-34(29-17-19-32(47)20-18-29)41(53)35(27-52)43(54)50-33-21-22-37(36(48)25-33)57-38-23-24-49-42(39(38)46)51-40(30-13-9-7-10-14-30)31-15-11-8-12-16-31/h7-27H,28H2,1-6H3,(H,50,54) |
| InChIKey | GCXUKCXHZPQGAV-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.28 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|