C23H30ClN5O3 — CID 86652644
tert-butyl 4-[6-(2-chloro-4-pyridinyl)-4-(propan-2-ylcarbamoyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 86652644) has the molecular formula C23H30ClN5O3 and a molecular weight of 459.98 g/mol. Its IUPAC name is tert-butyl 4-[6-(2-chloro-4-pyridinyl)-4-(propan-2-ylcarbamoyl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(2-chloro-4-pyridinyl)-4-(propan-2-ylcarbamoyl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86652644 |
| Molecular Formula | C23H30ClN5O3 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | tert-butyl 4-[6-(2-chloro-4-pyridinyl)-4-(propan-2-ylcarbamoyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)NC(=O)c1cc(-c2ccnc(Cl)c2)nc(N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C23H30ClN5O3/c1-15(2)26-21(30)17-12-18(16-6-7-25-19(24)13-16)27-20(14-17)28-8-10-29(11-9-28)22(31)32-23(3,4)5/h6-7,12-15H,8-11H2,1-5H3,(H,26,30) |
| InChIKey | XHHASCGAFOHGSF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|