C25H27F4NO3 — CID 86653897
5-fluoro-2-[4-hydroxy-2-methyl-4-(trifluoromethyl)hept-6-yn-2-yl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 86653897) has the molecular formula C25H27F4NO3 and a molecular weight of 465.49 g/mol. Its IUPAC name is 5-fluoro-2-[4-hydroxy-2-methyl-4-(trifluoromethyl)hept-6-yn-2-yl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]benzamide.
| Compound Name | 5-fluoro-2-[4-hydroxy-2-methyl-4-(trifluoromethyl)hept-6-yn-2-yl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 86653897 |
| Molecular Formula | C25H27F4NO3 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 5-fluoro-2-[4-hydroxy-2-methyl-4-(trifluoromethyl)hept-6-yn-2-yl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | C#CCC(O)(CC(C)(C)c1ccc(F)cc1C(=O)N[C@@H](C)c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H27F4NO3/c1-6-13-24(32,25(27,28)29)15-23(3,4)21-12-9-18(26)14-20(21)22(31)30-16(2)17-7-10-19(33-5)11-8-17/h1,7-12,14,16,32H,13,15H2,2-5H3,(H,30,31)/t16-,24?/m0/s1 |
| InChIKey | FKPOGVDBLDPJEE-FXIRQEPWSA-N |
| XLogP | 5.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|