C20H20FN3O5S — CID 86655915
methyl 2-[1-[(2R)-2-[(4-fluorophenyl)sulfonylamino]-4-oxobutyl]pyrrolo[2,3-b]pyridin-3-yl]acetate (PubChem CID 86655915) has the molecular formula C20H20FN3O5S and a molecular weight of 433.46 g/mol. Its IUPAC name is methyl 2-[1-[(2R)-2-[(4-fluorophenyl)sulfonylamino]-4-oxobutyl]pyrrolo[2,3-b]pyridin-3-yl]acetate.
| Compound Name | methyl 2-[1-[(2R)-2-[(4-fluorophenyl)sulfonylamino]-4-oxobutyl]pyrrolo[2,3-b]pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 86655915 |
| Molecular Formula | C20H20FN3O5S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | methyl 2-[1-[(2R)-2-[(4-fluorophenyl)sulfonylamino]-4-oxobutyl]pyrrolo[2,3-b]pyridin-3-yl]acetate |
| SMILES | COC(=O)Cc1cn(C[C@@H](CC=O)NS(=O)(=O)c2ccc(F)cc2)c2ncccc12 |
| InChI | InChI=1S/C20H20FN3O5S/c1-29-19(26)11-14-12-24(20-18(14)3-2-9-22-20)13-16(8-10-25)23-30(27,28)17-6-4-15(21)5-7-17/h2-7,9-10,12,16,23H,8,11,13H2,1H3/t16-/m1/s1 |
| InChIKey | DJVIKXBUOXGCJG-MRXNPFEDSA-N |
| XLogP | 1.83 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|