C20H17ClFN3O4S — CID 135061789
methyl 2-[2-chloro-8-[(4-fluorophenyl)sulfonylamino]-8,9-dihydropyrido[3,2-b]indolizin-5-yl]acetate (PubChem CID 135061789) has the molecular formula C20H17ClFN3O4S and a molecular weight of 449.89 g/mol. Its IUPAC name is methyl 2-[2-chloro-8-[(4-fluorophenyl)sulfonylamino]-8,9-dihydropyrido[3,2-b]indolizin-5-yl]acetate.
| Compound Name | methyl 2-[2-chloro-8-[(4-fluorophenyl)sulfonylamino]-8,9-dihydropyrido[3,2-b]indolizin-5-yl]acetate |
|---|---|
| PubChem CID | 135061789 |
| Molecular Formula | C20H17ClFN3O4S |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | methyl 2-[2-chloro-8-[(4-fluorophenyl)sulfonylamino]-8,9-dihydropyrido[3,2-b]indolizin-5-yl]acetate |
| SMILES | COC(=O)Cc1c2n(c3nc(Cl)ccc13)CC(NS(=O)(=O)c1ccc(F)cc1)C=C2 |
| InChI | InChI=1S/C20H17ClFN3O4S/c1-29-19(26)10-16-15-7-9-18(21)23-20(15)25-11-13(4-8-17(16)25)24-30(27,28)14-5-2-12(22)3-6-14/h2-9,13,24H,10-11H2,1H3 |
| InChIKey | HRVNOPHCQYJCMB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|