C11H14FNO3S — CID 104600641
4-fluoro-N-(3-methoxycyclobutyl)benzenesulfonamide (PubChem CID 104600641) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-fluoro-N-(3-methoxycyclobutyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(3-methoxycyclobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 104600641 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-fluoro-N-(3-methoxycyclobutyl)benzenesulfonamide |
| SMILES | COC1CC(NS(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C11H14FNO3S/c1-16-10-6-9(7-10)13-17(14,15)11-4-2-8(12)3-5-11/h2-5,9-10,13H,6-7H2,1H3 |
| InChIKey | KGDVJMKKDCCXQR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |