C17H17ClN4O2S — CID 86656306
5-(2-chloropyrimidin-4-yl)-N-(2-methoxyethyl)-4-(3-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 86656306) has the molecular formula C17H17ClN4O2S and a molecular weight of 376.87 g/mol. Its IUPAC name is 5-(2-chloropyrimidin-4-yl)-N-(2-methoxyethyl)-4-(3-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2-chloropyrimidin-4-yl)-N-(2-methoxyethyl)-4-(3-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 86656306 |
| Molecular Formula | C17H17ClN4O2S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 5-(2-chloropyrimidin-4-yl)-N-(2-methoxyethyl)-4-(3-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COCCNc1nc(-c2cccc(OC)c2)c(-c2ccnc(Cl)n2)s1 |
| InChI | InChI=1S/C17H17ClN4O2S/c1-23-9-8-20-17-22-14(11-4-3-5-12(10-11)24-2)15(25-17)13-6-7-19-16(18)21-13/h3-7,10H,8-9H2,1-2H3,(H,20,22) |
| InChIKey | QJURDXAEJUXETI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|