C11H17O3PTi — CID 86657313
ethyl-(3-hydroxy-1-phenylpropyl)phosphinic acid;titanium (PubChem CID 86657313) has the molecular formula C11H17O3PTi and a molecular weight of 276.09 g/mol. Its IUPAC name is ethyl-(3-hydroxy-1-phenylpropyl)phosphinic acid;titanium.
| Compound Name | ethyl-(3-hydroxy-1-phenylpropyl)phosphinic acid;titanium |
|---|---|
| PubChem CID | 86657313 |
| Molecular Formula | C11H17O3PTi |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | ethyl-(3-hydroxy-1-phenylpropyl)phosphinic acid;titanium |
| SMILES | CCP(=O)(O)C(CCO)c1ccccc1.[Ti] |
| InChI | InChI=1S/C11H17O3P.Ti/c1-2-15(13,14)11(8-9-12)10-6-4-3-5-7-10;/h3-7,11-12H,2,8-9H2,1H3,(H,13,14); |
| InChIKey | PUIMUJJBWLFJRR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|