About [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride
[1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride (PubChem CID 86659135) has the molecular formula C14H24ClN3O2
and a molecular weight of 301.82 g/mol. Its IUPAC name is [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride |
| PubChem CID | 86659135 |
| Molecular Formula | C14H24ClN3O2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride |
| SMILES | Cl.N#CCN1CCC(COC(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C14H23N3O2.ClH/c15-7-10-17-8-5-12(6-9-17)11-19-14(18)16-13-3-1-2-4-13;/h12-13H,1-6,8-11H2,(H,16,18);1H |
| InChIKey | OMSGRCHIVUZENY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride?
The IUPAC name of [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride (CID 86659135) is [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride.
What is the SMILES notation for [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride?
The canonical SMILES for [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride is Cl.N#CCN1CCC(COC(=O)NC2CCCC2)CC1.
What is the InChIKey of [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride?
The InChIKey is OMSGRCHIVUZENY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2.ClH/c15-7-10-17-8-5-12(6-9-17)11-19-14(18)16-13-3-1-2-4-13;/h12-13H,1-6,8-11H2,(H,16,18);1H.
What are the key properties of [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride?
[1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride has a molecular weight of 301.82 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(cyanomethyl)piperidin-4-yl]methyl N-cyclopentylcarbamate;hydrochloride is sourced from PubChem (CID 86659135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).