C8H2ClF7N2O — CID 86660075
4-(difluoromethyl)-2-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carbonyl chloride (PubChem CID 86660075) has the molecular formula C8H2ClF7N2O and a molecular weight of 310.56 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carbonyl chloride.
| Compound Name | 4-(difluoromethyl)-2-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carbonyl chloride |
|---|---|
| PubChem CID | 86660075 |
| Molecular Formula | C8H2ClF7N2O |
| Molecular Weight | 310.56 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 4-(difluoromethyl)-2-(1,1,2,2,2-pentafluoroethyl)pyrimidine-5-carbonyl chloride |
| SMILES | O=C(Cl)c1cnc(C(F)(F)C(F)(F)F)nc1C(F)F |
| InChI | InChI=1S/C8H2ClF7N2O/c9-4(19)2-1-17-6(18-3(2)5(10)11)7(12,13)8(14,15)16/h1,5H |
| InChIKey | BGFCXQGFPPYPGZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|