C35H47F5O9S2 — CID 86662331
2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]naphthalene;thiolan-1-ium (PubChem CID 86662331) has the molecular formula C35H47F5O9S2 and a molecular weight of 770.88 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]naphthalene;thiolan-1-ium.
| Compound Name | 2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]naphthalene;thiolan-1-ium |
|---|---|
| PubChem CID | 86662331 |
| Molecular Formula | C35H47F5O9S2 |
| Molecular Weight | 770.88 g/mol |
| Exact Mass | 770.26 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]naphthalene;thiolan-1-ium |
| SMILES | C1CC[SH+]C1.COCCOCCOCCOc1cccc2ccccc12.O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H22O4.C14H17F5O5S.C4H8S/c1-18-9-10-19-11-12-20-13-14-21-17-8-4-6-15-5-2-3-7-16(15)17;15-13(16,17)10(14(18,19)25(21,22)23)24-11(20)12-4-7-1-8(5-12)3-9(2-7)6-12;1-2-4-5-3-1/h2-8H,9-14H2,1H3;7-10H,1-6H2,(H,21,22,23);1-4H2 |
| InChIKey | VUIKGBRUBRCBPC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.88 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|