C14H7Cl2FN2O — CID 86662474
(3Z)-6-chloro-3-[(3-chloro-2-fluorophenyl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one (PubChem CID 86662474) has the molecular formula C14H7Cl2FN2O and a molecular weight of 309.13 g/mol. Its IUPAC name is (3Z)-6-chloro-3-[(3-chloro-2-fluorophenyl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one.
| Compound Name | (3Z)-6-chloro-3-[(3-chloro-2-fluorophenyl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 86662474 |
| Molecular Formula | C14H7Cl2FN2O |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | (3Z)-6-chloro-3-[(3-chloro-2-fluorophenyl)methylidene]-1H-pyrrolo[3,2-b]pyridin-2-one |
| SMILES | O=C1Nc2cc(Cl)cnc2/C1=C/c1cccc(Cl)c1F |
| InChI | InChI=1S/C14H7Cl2FN2O/c15-8-5-11-13(18-6-8)9(14(20)19-11)4-7-2-1-3-10(16)12(7)17/h1-6H,(H,19,20)/b9-4- |
| InChIKey | DQXYRZCXRFKXFY-WTKPLQERSA-N |
| XLogP | 4.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|