C22H16BrNO3S — CID 86664844
methyl 2-[5-[3-amino-4-(2-phenylethynyl)benzoyl]-2-bromothiophen-3-yl]acetate (PubChem CID 86664844) has the molecular formula C22H16BrNO3S and a molecular weight of 454.35 g/mol. Its IUPAC name is methyl 2-[5-[3-amino-4-(2-phenylethynyl)benzoyl]-2-bromothiophen-3-yl]acetate.
| Compound Name | methyl 2-[5-[3-amino-4-(2-phenylethynyl)benzoyl]-2-bromothiophen-3-yl]acetate |
|---|---|
| PubChem CID | 86664844 |
| Molecular Formula | C22H16BrNO3S |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | methyl 2-[5-[3-amino-4-(2-phenylethynyl)benzoyl]-2-bromothiophen-3-yl]acetate |
| SMILES | COC(=O)Cc1cc(C(=O)c2ccc(C#Cc3ccccc3)c(N)c2)sc1Br |
| InChI | InChI=1S/C22H16BrNO3S/c1-27-20(25)13-17-12-19(28-22(17)23)21(26)16-10-9-15(18(24)11-16)8-7-14-5-3-2-4-6-14/h2-6,9-12H,13,24H2,1H3 |
| InChIKey | OPLWTIMQFYZIHM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|