C23H18BrNO3S — CID 86664846
ethyl 2-[5-[3-amino-4-(2-phenylethynyl)benzoyl]-2-bromothiophen-3-yl]acetate (PubChem CID 86664846) has the molecular formula C23H18BrNO3S and a molecular weight of 468.37 g/mol. Its IUPAC name is ethyl 2-[5-[3-amino-4-(2-phenylethynyl)benzoyl]-2-bromothiophen-3-yl]acetate.
| Compound Name | ethyl 2-[5-[3-amino-4-(2-phenylethynyl)benzoyl]-2-bromothiophen-3-yl]acetate |
|---|---|
| PubChem CID | 86664846 |
| Molecular Formula | C23H18BrNO3S |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | ethyl 2-[5-[3-amino-4-(2-phenylethynyl)benzoyl]-2-bromothiophen-3-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(=O)c2ccc(C#Cc3ccccc3)c(N)c2)sc1Br |
| InChI | InChI=1S/C23H18BrNO3S/c1-2-28-21(26)14-18-13-20(29-23(18)24)22(27)17-11-10-16(19(25)12-17)9-8-15-6-4-3-5-7-15/h3-7,10-13H,2,14,25H2,1H3 |
| InChIKey | DNYKREYAPNPDEF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|