C16H16N4O3S2 — CID 86665448
1-(1H-indazol-4-yl)-3-(2-methoxy-5-methylsulfonylphenyl)thiourea (PubChem CID 86665448) has the molecular formula C16H16N4O3S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(1H-indazol-4-yl)-3-(2-methoxy-5-methylsulfonylphenyl)thiourea.
| Compound Name | 1-(1H-indazol-4-yl)-3-(2-methoxy-5-methylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 86665448 |
| Molecular Formula | C16H16N4O3S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-(1H-indazol-4-yl)-3-(2-methoxy-5-methylsulfonylphenyl)thiourea |
| SMILES | COc1ccc(S(C)(=O)=O)cc1NC(=S)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C16H16N4O3S2/c1-23-15-7-6-10(25(2,21)22)8-14(15)19-16(24)18-12-4-3-5-13-11(12)9-17-20-13/h3-9H,1-2H3,(H,17,20)(H2,18,19,24) |
| InChIKey | ICPNYFBMHGYXAD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|