C19H22N4O3S2 — CID 86665478
1-(1-methylbenzimidazol-4-yl)-3-(5-methylsulfonyl-2-propan-2-yloxyphenyl)thiourea (PubChem CID 86665478) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-(1-methylbenzimidazol-4-yl)-3-(5-methylsulfonyl-2-propan-2-yloxyphenyl)thiourea.
| Compound Name | 1-(1-methylbenzimidazol-4-yl)-3-(5-methylsulfonyl-2-propan-2-yloxyphenyl)thiourea |
|---|---|
| PubChem CID | 86665478 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 1-(1-methylbenzimidazol-4-yl)-3-(5-methylsulfonyl-2-propan-2-yloxyphenyl)thiourea |
| SMILES | CC(C)Oc1ccc(S(C)(=O)=O)cc1NC(=S)Nc1cccc2c1ncn2C |
| InChI | InChI=1S/C19H22N4O3S2/c1-12(2)26-17-9-8-13(28(4,24)25)10-15(17)22-19(27)21-14-6-5-7-16-18(14)20-11-23(16)3/h5-12H,1-4H3,(H2,21,22,27) |
| InChIKey | NCSQLSNGUURISZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|