C18H20N4O3S2 — CID 152802465
2-[2-methoxy-5-(methylsulfamoyl)phenyl]-N-(1-methylbenzimidazol-4-yl)ethanethioamide (PubChem CID 152802465) has the molecular formula C18H20N4O3S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[2-methoxy-5-(methylsulfamoyl)phenyl]-N-(1-methylbenzimidazol-4-yl)ethanethioamide.
| Compound Name | 2-[2-methoxy-5-(methylsulfamoyl)phenyl]-N-(1-methylbenzimidazol-4-yl)ethanethioamide |
|---|---|
| PubChem CID | 152802465 |
| Molecular Formula | C18H20N4O3S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[2-methoxy-5-(methylsulfamoyl)phenyl]-N-(1-methylbenzimidazol-4-yl)ethanethioamide |
| SMILES | CNS(=O)(=O)c1ccc(OC)c(CC(=S)Nc2cccc3c2ncn3C)c1 |
| InChI | InChI=1S/C18H20N4O3S2/c1-19-27(23,24)13-7-8-16(25-3)12(9-13)10-17(26)21-14-5-4-6-15-18(14)20-11-22(15)2/h4-9,11,19H,10H2,1-3H3,(H,21,26) |
| InChIKey | SOGXSTVAEXDRCF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|