C18H13F3N4OS — CID 162072335
2-[4-cyano-2-(trifluoromethoxy)phenyl]-N-(1-methylbenzimidazol-4-yl)ethanethioamide (PubChem CID 162072335) has the molecular formula C18H13F3N4OS and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-[4-cyano-2-(trifluoromethoxy)phenyl]-N-(1-methylbenzimidazol-4-yl)ethanethioamide.
| Compound Name | 2-[4-cyano-2-(trifluoromethoxy)phenyl]-N-(1-methylbenzimidazol-4-yl)ethanethioamide |
|---|---|
| PubChem CID | 162072335 |
| Molecular Formula | C18H13F3N4OS |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-[4-cyano-2-(trifluoromethoxy)phenyl]-N-(1-methylbenzimidazol-4-yl)ethanethioamide |
| SMILES | Cn1cnc2c(NC(=S)Cc3ccc(C#N)cc3OC(F)(F)F)cccc21 |
| InChI | InChI=1S/C18H13F3N4OS/c1-25-10-23-17-13(3-2-4-14(17)25)24-16(27)8-12-6-5-11(9-22)7-15(12)26-18(19,20)21/h2-7,10H,8H2,1H3,(H,24,27) |
| InChIKey | ZBGHDPVBNUKQMW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|