C17H18N4OS — CID 147046325
N-(2,3-dimethylbenzimidazol-4-yl)-2-(4-methoxy-3-pyridinyl)ethanethioamide (PubChem CID 147046325) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is N-(2,3-dimethylbenzimidazol-4-yl)-2-(4-methoxy-3-pyridinyl)ethanethioamide.
| Compound Name | N-(2,3-dimethylbenzimidazol-4-yl)-2-(4-methoxy-3-pyridinyl)ethanethioamide |
|---|---|
| PubChem CID | 147046325 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-(2,3-dimethylbenzimidazol-4-yl)-2-(4-methoxy-3-pyridinyl)ethanethioamide |
| SMILES | COc1ccncc1CC(=S)Nc1cccc2nc(C)n(C)c12 |
| InChI | InChI=1S/C17H18N4OS/c1-11-19-13-5-4-6-14(17(13)21(11)2)20-16(23)9-12-10-18-8-7-15(12)22-3/h4-8,10H,9H2,1-3H3,(H,20,23) |
| InChIKey | BALJQORNAUJIPH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|