C18H20N4O4S2 — CID 87944548
1-(2,3-dimethylbenzimidazol-4-yl)-3-(2-methoxy-5-methylsulfonylphenyl)-1-sulfanylurea (PubChem CID 87944548) has the molecular formula C18H20N4O4S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-(2,3-dimethylbenzimidazol-4-yl)-3-(2-methoxy-5-methylsulfonylphenyl)-1-sulfanylurea.
| Compound Name | 1-(2,3-dimethylbenzimidazol-4-yl)-3-(2-methoxy-5-methylsulfonylphenyl)-1-sulfanylurea |
|---|---|
| PubChem CID | 87944548 |
| Molecular Formula | C18H20N4O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 1-(2,3-dimethylbenzimidazol-4-yl)-3-(2-methoxy-5-methylsulfonylphenyl)-1-sulfanylurea |
| SMILES | COc1ccc(S(C)(=O)=O)cc1NC(=O)N(S)c1cccc2nc(C)n(C)c12 |
| InChI | InChI=1S/C18H20N4O4S2/c1-11-19-13-6-5-7-15(17(13)21(11)2)22(27)18(23)20-14-10-12(28(4,24)25)8-9-16(14)26-3/h5-10,27H,1-4H3,(H,20,23) |
| InChIKey | ZCKQODMZVMKJLZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|