C19H18F4N4OS — CID 86665473
1-(5-fluoro-2-propan-2-yloxyphenyl)-3-[3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea (PubChem CID 86665473) has the molecular formula C19H18F4N4OS and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-(5-fluoro-2-propan-2-yloxyphenyl)-3-[3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea.
| Compound Name | 1-(5-fluoro-2-propan-2-yloxyphenyl)-3-[3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea |
|---|---|
| PubChem CID | 86665473 |
| Molecular Formula | C19H18F4N4OS |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-(5-fluoro-2-propan-2-yloxyphenyl)-3-[3-(2,2,2-trifluoroethyl)benzimidazol-4-yl]thiourea |
| SMILES | CC(C)Oc1ccc(F)cc1NC(=S)Nc1cccc2ncn(CC(F)(F)F)c12 |
| InChI | InChI=1S/C19H18F4N4OS/c1-11(2)28-16-7-6-12(20)8-15(16)26-18(29)25-14-5-3-4-13-17(14)27(10-24-13)9-19(21,22)23/h3-8,10-11H,9H2,1-2H3,(H2,25,26,29) |
| InChIKey | PGNSBNFUPNFYSH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|