C18H19FN4OS — CID 86665456
1-(3-ethyl-2-methylbenzimidazol-4-yl)-3-(5-fluoro-2-methoxyphenyl)thiourea (PubChem CID 86665456) has the molecular formula C18H19FN4OS and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(3-ethyl-2-methylbenzimidazol-4-yl)-3-(5-fluoro-2-methoxyphenyl)thiourea.
| Compound Name | 1-(3-ethyl-2-methylbenzimidazol-4-yl)-3-(5-fluoro-2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 86665456 |
| Molecular Formula | C18H19FN4OS |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-(3-ethyl-2-methylbenzimidazol-4-yl)-3-(5-fluoro-2-methoxyphenyl)thiourea |
| SMILES | CCn1c(C)nc2cccc(NC(=S)Nc3cc(F)ccc3OC)c21 |
| InChI | InChI=1S/C18H19FN4OS/c1-4-23-11(2)20-13-6-5-7-14(17(13)23)21-18(25)22-15-10-12(19)8-9-16(15)24-3/h5-10H,4H2,1-3H3,(H2,21,22,25) |
| InChIKey | NVGLABOGPRJBRK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|