About 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile
2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile (PubChem CID 86667451) has the molecular formula C12H14ClFN4O
and a molecular weight of 284.72 g/mol. Its IUPAC name is 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile |
| PubChem CID | 86667451 |
| Molecular Formula | C12H14ClFN4O |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile |
| SMILES | N#CC[C@]1(O)CCC[C@H](Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C12H14ClFN4O/c13-11-16-7-9(14)10(18-11)17-8-2-1-3-12(19,6-8)4-5-15/h7-8,19H,1-4,6H2,(H,16,17,18)/t8-,12+/m0/s1 |
| InChIKey | FIPNTFRTZMYFIW-QPUJVOFHSA-N |
| XLogP | 2.27 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile?
The IUPAC name of 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile (CID 86667451) is 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile.
What is the SMILES notation for 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile?
The canonical SMILES for 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile is N#CC[C@]1(O)CCC[C@H](Nc2nc(Cl)ncc2F)C1.
What is the InChIKey of 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile?
The InChIKey is FIPNTFRTZMYFIW-QPUJVOFHSA-N. The full InChI is InChI=1S/C12H14ClFN4O/c13-11-16-7-9(14)10(18-11)17-8-2-1-3-12(19,6-8)4-5-15/h7-8,19H,1-4,6H2,(H,16,17,18)/t8-,12+/m0/s1.
What are the key properties of 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile?
2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile has a molecular weight of 284.72 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]acetonitrile is sourced from PubChem (CID 86667451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).