C16H13F2N3O — CID 86669490
N-[(3,4-difluorophenyl)methyl]-2-(prop-2-ynylamino)pyridine-3-carboxamide (PubChem CID 86669490) has the molecular formula C16H13F2N3O and a molecular weight of 301.30 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-2-(prop-2-ynylamino)pyridine-3-carboxamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-2-(prop-2-ynylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86669490 |
| Molecular Formula | C16H13F2N3O |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-2-(prop-2-ynylamino)pyridine-3-carboxamide |
| SMILES | C#CCNc1ncccc1C(=O)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13F2N3O/c1-2-7-19-15-12(4-3-8-20-15)16(22)21-10-11-5-6-13(17)14(18)9-11/h1,3-6,8-9H,7,10H2,(H,19,20)(H,21,22) |
| InChIKey | WANJFUFDYTYQDB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|