C23H24BF2N3O5 — CID 142769027
[3-[[[3-[(3,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]amino]methyl]-5-propan-2-yloxyphenoxy]boronic acid (PubChem CID 142769027) has the molecular formula C23H24BF2N3O5 and a molecular weight of 471.27 g/mol. Its IUPAC name is [3-[[[3-[(3,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]amino]methyl]-5-propan-2-yloxyphenoxy]boronic acid.
| Compound Name | [3-[[[3-[(3,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]amino]methyl]-5-propan-2-yloxyphenoxy]boronic acid |
|---|---|
| PubChem CID | 142769027 |
| Molecular Formula | C23H24BF2N3O5 |
| Molecular Weight | 471.27 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | [3-[[[3-[(3,4-difluorophenyl)methylcarbamoyl]-2-pyridinyl]amino]methyl]-5-propan-2-yloxyphenoxy]boronic acid |
| SMILES | CC(C)Oc1cc(CNc2ncccc2C(=O)NCc2ccc(F)c(F)c2)cc(OB(O)O)c1 |
| InChI | InChI=1S/C23H24BF2N3O5/c1-14(2)33-17-8-16(9-18(11-17)34-24(31)32)13-28-22-19(4-3-7-27-22)23(30)29-12-15-5-6-20(25)21(26)10-15/h3-11,14,31-32H,12-13H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | IUSFVKLWCUOBOT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|