C25H21F2N9O2S — CID 172636541
N-[(3,4-difluorophenyl)methyl]-2-[[5-(5-hydroxy-5,6-dihydro-3H-pentazolo[1,2-a][1,2,4]benzotriazin-9-yl)thiophen-2-yl]methylamino]pyridine-3-carboxamide (PubChem CID 172636541) has the molecular formula C25H21F2N9O2S and a molecular weight of 549.57 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-2-[[5-(5-hydroxy-5,6-dihydro-3H-pentazolo[1,2-a][1,2,4]benzotriazin-9-yl)thiophen-2-yl]methylamino]pyridine-3-carboxamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-2-[[5-(5-hydroxy-5,6-dihydro-3H-pentazolo[1,2-a][1,2,4]benzotriazin-9-yl)thiophen-2-yl]methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172636541 |
| Molecular Formula | C25H21F2N9O2S |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-2-[[5-(5-hydroxy-5,6-dihydro-3H-pentazolo[1,2-a][1,2,4]benzotriazin-9-yl)thiophen-2-yl]methylamino]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(F)c1)c1cccnc1NCc1ccc(-c2ccc3c(c2)N2N=NNN2C(O)N3)s1 |
| InChI | InChI=1S/C25H21F2N9O2S/c26-18-6-3-14(10-19(18)27)12-30-24(37)17-2-1-9-28-23(17)29-13-16-5-8-22(39-16)15-4-7-20-21(11-15)35-33-32-34-36(35)25(38)31-20/h1-11,25,31,38H,12-13H2,(H,28,29)(H,30,37)(H,33,34) |
| InChIKey | ZGRUKSLWRXRCKO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 129.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |