C17H20ClN5OS — CID 86671798
N-[3-[4-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylphenyl]acetamide (PubChem CID 86671798) has the molecular formula C17H20ClN5OS and a molecular weight of 377.90 g/mol. Its IUPAC name is N-[3-[4-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylphenyl]acetamide.
| Compound Name | N-[3-[4-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 86671798 |
| Molecular Formula | C17H20ClN5OS |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[3-[4-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Sc2cnc(N3CCN(C)CC3)nc2Cl)c1 |
| InChI | InChI=1S/C17H20ClN5OS/c1-12(24)20-13-4-3-5-14(10-13)25-15-11-19-17(21-16(15)18)23-8-6-22(2)7-9-23/h3-5,10-11H,6-9H2,1-2H3,(H,20,24) |
| InChIKey | YQOJQAJNINXZJT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |