C22H22ClN3O4 — CID 86672043
2-methylpropyl 6-(4-carbonochloridoyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)benzimidazole-1-carboxylate (PubChem CID 86672043) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is 2-methylpropyl 6-(4-carbonochloridoyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)benzimidazole-1-carboxylate.
| Compound Name | 2-methylpropyl 6-(4-carbonochloridoyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 86672043 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-methylpropyl 6-(4-carbonochloridoyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)benzimidazole-1-carboxylate |
| SMILES | CC(C)COC(=O)n1cnc2ccc(-c3ccc4c(c3)CN(C(=O)Cl)CCO4)cc21 |
| InChI | InChI=1S/C22H22ClN3O4/c1-14(2)12-30-22(28)26-13-24-18-5-3-16(10-19(18)26)15-4-6-20-17(9-15)11-25(21(23)27)7-8-29-20/h3-6,9-10,13-14H,7-8,11-12H2,1-2H3 |
| InChIKey | NZKVTUQDPGSOSF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|