C13H14LiN3O2 — CID 86673019
lithium (2S)-2-amino-4-[2-(1H-imidazol-5-yl)phenyl]butanoate (PubChem CID 86673019) has the molecular formula C13H14LiN3O2 and a molecular weight of 251.22 g/mol. Its IUPAC name is lithium (2S)-2-amino-4-[2-(1H-imidazol-5-yl)phenyl]butanoate.
| Compound Name | lithium (2S)-2-amino-4-[2-(1H-imidazol-5-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 86673019 |
| Molecular Formula | C13H14LiN3O2 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | lithium (2S)-2-amino-4-[2-(1H-imidazol-5-yl)phenyl]butanoate |
| SMILES | N[C@@H](CCc1ccccc1-c1cnc[nH]1)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C13H15N3O2.Li/c14-11(13(17)18)6-5-9-3-1-2-4-10(9)12-7-15-8-16-12;/h1-4,7-8,11H,5-6,14H2,(H,15,16)(H,17,18);/q;+1/p-1/t11-;/m0./s1 |
| InChIKey | QNXAFGCXGYXDRZ-MERQFXBCSA-M |
| XLogP | -2.91 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |